C15H11ClF2N2 — CID 43686857
2-chloro-5-[1-(2,6-difluorophenyl)ethylamino]benzonitrile (PubChem CID 43686857) has the molecular formula C15H11ClF2N2 and a molecular weight of 292.72 g/mol. Its IUPAC name is 2-chloro-5-[1-(2,6-difluorophenyl)ethylamino]benzonitrile.
| Compound Name | 2-chloro-5-[1-(2,6-difluorophenyl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 43686857 |
| Molecular Formula | C15H11ClF2N2 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-chloro-5-[1-(2,6-difluorophenyl)ethylamino]benzonitrile |
| SMILES | CC(Nc1ccc(Cl)c(C#N)c1)c1c(F)cccc1F |
| InChI | InChI=1S/C15H11ClF2N2/c1-9(15-13(17)3-2-4-14(15)18)20-11-5-6-12(16)10(7-11)8-19/h2-7,9,20H,1H3 |
| InChIKey | WEUAOKLKJWYNBY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |