C10H9ClF2N2 — CID 102868440
2-chloro-5-(1,1-difluoropropan-2-ylamino)benzonitrile (PubChem CID 102868440) has the molecular formula C10H9ClF2N2 and a molecular weight of 230.65 g/mol. Its IUPAC name is 2-chloro-5-(1,1-difluoropropan-2-ylamino)benzonitrile.
| Compound Name | 2-chloro-5-(1,1-difluoropropan-2-ylamino)benzonitrile |
|---|---|
| PubChem CID | 102868440 |
| Molecular Formula | C10H9ClF2N2 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-chloro-5-(1,1-difluoropropan-2-ylamino)benzonitrile |
| SMILES | CC(Nc1ccc(Cl)c(C#N)c1)C(F)F |
| InChI | InChI=1S/C10H9ClF2N2/c1-6(10(12)13)15-8-2-3-9(11)7(4-8)5-14/h2-4,6,10,15H,1H3 |
| InChIKey | RDLVBIZISYWJJS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |