C9H10ClF2N — CID 102867820
4-chloro-N-(1,1-difluoropropan-2-yl)aniline (PubChem CID 102867820) has the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. Its IUPAC name is 4-chloro-N-(1,1-difluoropropan-2-yl)aniline.
| Compound Name | 4-chloro-N-(1,1-difluoropropan-2-yl)aniline |
|---|---|
| PubChem CID | 102867820 |
| Molecular Formula | C9H10ClF2N |
| Molecular Weight | 205.63 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 4-chloro-N-(1,1-difluoropropan-2-yl)aniline |
| SMILES | CC(Nc1ccc(Cl)cc1)C(F)F |
| InChI | InChI=1S/C9H10ClF2N/c1-6(9(11)12)13-8-4-2-7(10)3-5-8/h2-6,9,13H,1H3 |
| InChIKey | WZPNTSHBLOEGDO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.63 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |