C10H12F3N — CID 102867861
N-(1,1-difluoropropan-2-yl)-3-fluoro-4-methylaniline (PubChem CID 102867861) has the molecular formula C10H12F3N and a molecular weight of 203.21 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)-3-fluoro-4-methylaniline.
| Compound Name | N-(1,1-difluoropropan-2-yl)-3-fluoro-4-methylaniline |
|---|---|
| PubChem CID | 102867861 |
| Molecular Formula | C10H12F3N |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)-3-fluoro-4-methylaniline |
| SMILES | Cc1ccc(NC(C)C(F)F)cc1F |
| InChI | InChI=1S/C10H12F3N/c1-6-3-4-8(5-9(6)11)14-7(2)10(12)13/h3-5,7,10,14H,1-2H3 |
| InChIKey | NMWODZROPKOKTF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |