C11H11F2N3 — CID 102869134
N-(1,1-difluoropropan-2-yl)quinoxalin-6-amine (PubChem CID 102869134) has the molecular formula C11H11F2N3 and a molecular weight of 223.23 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)quinoxalin-6-amine.
| Compound Name | N-(1,1-difluoropropan-2-yl)quinoxalin-6-amine |
|---|---|
| PubChem CID | 102869134 |
| Molecular Formula | C11H11F2N3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)quinoxalin-6-amine |
| SMILES | CC(Nc1ccc2nccnc2c1)C(F)F |
| InChI | InChI=1S/C11H11F2N3/c1-7(11(12)13)16-8-2-3-9-10(6-8)15-5-4-14-9/h2-7,11,16H,1H3 |
| InChIKey | SGMIGNDWRLMVPE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |