C15H21BrClNO — CID 43689269
3-bromo-5-chloro-N-(4-ethylcyclohexyl)-2-methoxyaniline (PubChem CID 43689269) has the molecular formula C15H21BrClNO and a molecular weight of 346.70 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-(4-ethylcyclohexyl)-2-methoxyaniline.
| Compound Name | 3-bromo-5-chloro-N-(4-ethylcyclohexyl)-2-methoxyaniline |
|---|---|
| PubChem CID | 43689269 |
| Molecular Formula | C15H21BrClNO |
| Molecular Weight | 346.70 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 3-bromo-5-chloro-N-(4-ethylcyclohexyl)-2-methoxyaniline |
| SMILES | CCC1CCC(Nc2cc(Cl)cc(Br)c2OC)CC1 |
| InChI | InChI=1S/C15H21BrClNO/c1-3-10-4-6-12(7-5-10)18-14-9-11(17)8-13(16)15(14)19-2/h8-10,12,18H,3-7H2,1-2H3 |
| InChIKey | PVLCKAURBLLHJU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.70 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |