C12H15ClN4OS — CID 43690083
5-[[(2-chloro-3-pyridinyl)amino]methyl]-4-methoxy-N,N-dimethyl-1,3-thiazol-2-amine (PubChem CID 43690083) has the molecular formula C12H15ClN4OS and a molecular weight of 298.80 g/mol. Its IUPAC name is 5-[[(2-chloro-3-pyridinyl)amino]methyl]-4-methoxy-N,N-dimethyl-1,3-thiazol-2-amine.
| Compound Name | 5-[[(2-chloro-3-pyridinyl)amino]methyl]-4-methoxy-N,N-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43690083 |
| Molecular Formula | C12H15ClN4OS |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 5-[[(2-chloro-3-pyridinyl)amino]methyl]-4-methoxy-N,N-dimethyl-1,3-thiazol-2-amine |
| SMILES | COc1nc(N(C)C)sc1CNc1cccnc1Cl |
| InChI | InChI=1S/C12H15ClN4OS/c1-17(2)12-16-11(18-3)9(19-12)7-15-8-5-4-6-14-10(8)13/h4-6,15H,7H2,1-3H3 |
| InChIKey | WSGCRWQQSPULAA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|