C14H14Cl2N2O2 — CID 43782434
2-chloro-N-[(3-chloro-4,5-dimethoxyphenyl)methyl]pyridin-3-amine (PubChem CID 43782434) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is 2-chloro-N-[(3-chloro-4,5-dimethoxyphenyl)methyl]pyridin-3-amine.
| Compound Name | 2-chloro-N-[(3-chloro-4,5-dimethoxyphenyl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 43782434 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-chloro-N-[(3-chloro-4,5-dimethoxyphenyl)methyl]pyridin-3-amine |
| SMILES | COc1cc(CNc2cccnc2Cl)cc(Cl)c1OC |
| InChI | InChI=1S/C14H14Cl2N2O2/c1-19-12-7-9(6-10(15)13(12)20-2)8-18-11-4-3-5-17-14(11)16/h3-7,18H,8H2,1-2H3 |
| InChIKey | VRNZGGHJWUFNGX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|