C15H18BrN3S — CID 43690352
N-[(5-bromothiophen-3-yl)methyl]-6-piperidin-1-ylpyridin-3-amine (PubChem CID 43690352) has the molecular formula C15H18BrN3S and a molecular weight of 352.30 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-6-piperidin-1-ylpyridin-3-amine.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-6-piperidin-1-ylpyridin-3-amine |
|---|---|
| PubChem CID | 43690352 |
| Molecular Formula | C15H18BrN3S |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-6-piperidin-1-ylpyridin-3-amine |
| SMILES | Brc1cc(CNc2ccc(N3CCCCC3)nc2)cs1 |
| InChI | InChI=1S/C15H18BrN3S/c16-14-8-12(11-20-14)9-17-13-4-5-15(18-10-13)19-6-2-1-3-7-19/h4-5,8,10-11,17H,1-3,6-7,9H2 |
| InChIKey | PCQQCIOSENLRPH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |