C16H22ClNOS — CID 43696000
5-chloro-N-(2-cyclopentylsulfanylphenyl)pentanamide (PubChem CID 43696000) has the molecular formula C16H22ClNOS and a molecular weight of 311.88 g/mol. Its IUPAC name is 5-chloro-N-(2-cyclopentylsulfanylphenyl)pentanamide.
| Compound Name | 5-chloro-N-(2-cyclopentylsulfanylphenyl)pentanamide |
|---|---|
| PubChem CID | 43696000 |
| Molecular Formula | C16H22ClNOS |
| Molecular Weight | 311.88 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 5-chloro-N-(2-cyclopentylsulfanylphenyl)pentanamide |
| SMILES | O=C(CCCCCl)Nc1ccccc1SC1CCCC1 |
| InChI | InChI=1S/C16H22ClNOS/c17-12-6-5-11-16(19)18-14-9-3-4-10-15(14)20-13-7-1-2-8-13/h3-4,9-10,13H,1-2,5-8,11-12H2,(H,18,19) |
| InChIKey | KLPFVQPIVABEFY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.88 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|