C14H18FN3O — CID 43696372
2-amino-5-fluoro-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzamide (PubChem CID 43696372) has the molecular formula C14H18FN3O and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-amino-5-fluoro-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzamide.
| Compound Name | 2-amino-5-fluoro-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzamide |
|---|---|
| PubChem CID | 43696372 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-amino-5-fluoro-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzamide |
| SMILES | Nc1ccc(F)cc1C(=O)NC1CCN2CCCC12 |
| InChI | InChI=1S/C14H18FN3O/c15-9-3-4-11(16)10(8-9)14(19)17-12-5-7-18-6-1-2-13(12)18/h3-4,8,12-13H,1-2,5-7,16H2,(H,17,19) |
| InChIKey | KFIWZPWRXAIPBX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|