C11H17ClF3NO2 — CID 43696429
3-chloro-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]propanamide (PubChem CID 43696429) has the molecular formula C11H17ClF3NO2 and a molecular weight of 287.71 g/mol. Its IUPAC name is 3-chloro-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]propanamide.
| Compound Name | 3-chloro-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 43696429 |
| Molecular Formula | C11H17ClF3NO2 |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-chloro-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]propanamide |
| SMILES | O=C(CCCl)NC1CCCC(OCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H17ClF3NO2/c12-5-4-10(17)16-8-2-1-3-9(6-8)18-7-11(13,14)15/h8-9H,1-7H2,(H,16,17) |
| InChIKey | LNYZLDFNTODZEI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|