C16H21F3N2O3 — CID 38885386
1-(4-methoxyphenyl)-3-[(1S,3R)-3-(2,2,2-trifluoroethoxy)cyclohexyl]urea (PubChem CID 38885386) has the molecular formula C16H21F3N2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[(1S,3R)-3-(2,2,2-trifluoroethoxy)cyclohexyl]urea.
| Compound Name | 1-(4-methoxyphenyl)-3-[(1S,3R)-3-(2,2,2-trifluoroethoxy)cyclohexyl]urea |
|---|---|
| PubChem CID | 38885386 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[(1S,3R)-3-(2,2,2-trifluoroethoxy)cyclohexyl]urea |
| SMILES | COc1ccc(NC(=O)N[C@H]2CCC[C@@H](OCC(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C16H21F3N2O3/c1-23-13-7-5-11(6-8-13)20-15(22)21-12-3-2-4-14(9-12)24-10-16(17,18)19/h5-8,12,14H,2-4,9-10H2,1H3,(H2,20,21,22)/t12-,14+/m0/s1 |
| InChIKey | OVLVATYALMXLDV-GXTWGEPZSA-N |
| XLogP | 3.71 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |