C17H17N3O — CID 43704850
4-(2-methyl-1,3-oxazol-4-yl)-N-(1-pyridin-4-ylethyl)aniline (PubChem CID 43704850) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is 4-(2-methyl-1,3-oxazol-4-yl)-N-(1-pyridin-4-ylethyl)aniline.
| Compound Name | 4-(2-methyl-1,3-oxazol-4-yl)-N-(1-pyridin-4-ylethyl)aniline |
|---|---|
| PubChem CID | 43704850 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 4-(2-methyl-1,3-oxazol-4-yl)-N-(1-pyridin-4-ylethyl)aniline |
| SMILES | Cc1nc(-c2ccc(NC(C)c3ccncc3)cc2)co1 |
| InChI | InChI=1S/C17H17N3O/c1-12(14-7-9-18-10-8-14)19-16-5-3-15(4-6-16)17-11-21-13(2)20-17/h3-12,19H,1-2H3 |
| InChIKey | BVRUAYLGFJIOFZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |