C15H24N2O3S — CID 43707473
2-amino-N-[1-(4-methylphenyl)propyl]-4-methylsulfonylbutanamide (PubChem CID 43707473) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 2-amino-N-[1-(4-methylphenyl)propyl]-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-[1-(4-methylphenyl)propyl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 43707473 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-amino-N-[1-(4-methylphenyl)propyl]-4-methylsulfonylbutanamide |
| SMILES | CCC(NC(=O)C(N)CCS(C)(=O)=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H24N2O3S/c1-4-14(12-7-5-11(2)6-8-12)17-15(18)13(16)9-10-21(3,19)20/h5-8,13-14H,4,9-10,16H2,1-3H3,(H,17,18) |
| InChIKey | MDPSUVHCQMPHEO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |