C13H10Br2N2O — CID 43714178
3-amino-N-(2,5-dibromophenyl)benzamide (PubChem CID 43714178) has the molecular formula C13H10Br2N2O and a molecular weight of 370.04 g/mol. Its IUPAC name is 3-amino-N-(2,5-dibromophenyl)benzamide.
| Compound Name | 3-amino-N-(2,5-dibromophenyl)benzamide |
|---|---|
| PubChem CID | 43714178 |
| Molecular Formula | C13H10Br2N2O |
| Molecular Weight | 370.04 g/mol |
| Exact Mass | 367.92 |
| IUPAC Name | 3-amino-N-(2,5-dibromophenyl)benzamide |
| SMILES | Nc1cccc(C(=O)Nc2cc(Br)ccc2Br)c1 |
| InChI | InChI=1S/C13H10Br2N2O/c14-9-4-5-11(15)12(7-9)17-13(18)8-2-1-3-10(16)6-8/h1-7H,16H2,(H,17,18) |
| InChIKey | JQLFXMQGWMSHHF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.04 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|