C14H9Br2N3O — CID 61261029
N-(2,5-dibromophenyl)-3H-benzimidazole-5-carboxamide (PubChem CID 61261029) has the molecular formula C14H9Br2N3O and a molecular weight of 395.05 g/mol. Its IUPAC name is N-(2,5-dibromophenyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(2,5-dibromophenyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 61261029 |
| Molecular Formula | C14H9Br2N3O |
| Molecular Weight | 395.05 g/mol |
| Exact Mass | 392.91 |
| IUPAC Name | N-(2,5-dibromophenyl)-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(Nc1cc(Br)ccc1Br)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C14H9Br2N3O/c15-9-2-3-10(16)12(6-9)19-14(20)8-1-4-11-13(5-8)18-7-17-11/h1-7H,(H,17,18)(H,19,20) |
| InChIKey | YSHGHGQRVMHNEJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.05 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |