C14H8BrCl2N3O — CID 107792772
N-(4-bromo-2,3-dichlorophenyl)-3H-benzimidazole-5-carboxamide (PubChem CID 107792772) has the molecular formula C14H8BrCl2N3O and a molecular weight of 385.05 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 107792772 |
| Molecular Formula | C14H8BrCl2N3O |
| Molecular Weight | 385.05 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(Br)c(Cl)c1Cl)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C14H8BrCl2N3O/c15-8-2-4-10(13(17)12(8)16)20-14(21)7-1-3-9-11(5-7)19-6-18-9/h1-6H,(H,18,19)(H,20,21) |
| InChIKey | MGXAJTCCMWLNPS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.05 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|