C11H16N4O4S — CID 43715625
2-[(1-pyrimidin-2-ylpiperidin-3-yl)sulfamoyl]acetic acid (PubChem CID 43715625) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-[(1-pyrimidin-2-ylpiperidin-3-yl)sulfamoyl]acetic acid.
| Compound Name | 2-[(1-pyrimidin-2-ylpiperidin-3-yl)sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 43715625 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-[(1-pyrimidin-2-ylpiperidin-3-yl)sulfamoyl]acetic acid |
| SMILES | O=C(O)CS(=O)(=O)NC1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C11H16N4O4S/c16-10(17)8-20(18,19)14-9-3-1-6-15(7-9)11-12-4-2-5-13-11/h2,4-5,9,14H,1,3,6-8H2,(H,16,17) |
| InChIKey | XAGJAUXZIZCYNS-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |