C17H17ClIN — CID 43716337
N-[3-(4-chlorophenyl)cyclobutyl]-3-iodo-4-methylaniline (PubChem CID 43716337) has the molecular formula C17H17ClIN and a molecular weight of 397.69 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)cyclobutyl]-3-iodo-4-methylaniline.
| Compound Name | N-[3-(4-chlorophenyl)cyclobutyl]-3-iodo-4-methylaniline |
|---|---|
| PubChem CID | 43716337 |
| Molecular Formula | C17H17ClIN |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | N-[3-(4-chlorophenyl)cyclobutyl]-3-iodo-4-methylaniline |
| SMILES | Cc1ccc(NC2CC(c3ccc(Cl)cc3)C2)cc1I |
| InChI | InChI=1S/C17H17ClIN/c1-11-2-7-15(10-17(11)19)20-16-8-13(9-16)12-3-5-14(18)6-4-12/h2-7,10,13,16,20H,8-9H2,1H3 |
| InChIKey | OHYQPONWIVVBFV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|