C17H28N2O2 — CID 43717361
N-(4-ethoxy-3-methoxyphenyl)-1,2,5-trimethylpiperidin-4-amine (PubChem CID 43717361) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is N-(4-ethoxy-3-methoxyphenyl)-1,2,5-trimethylpiperidin-4-amine.
| Compound Name | N-(4-ethoxy-3-methoxyphenyl)-1,2,5-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 43717361 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N-(4-ethoxy-3-methoxyphenyl)-1,2,5-trimethylpiperidin-4-amine |
| SMILES | CCOc1ccc(NC2CC(C)N(C)CC2C)cc1OC |
| InChI | InChI=1S/C17H28N2O2/c1-6-21-16-8-7-14(10-17(16)20-5)18-15-9-13(3)19(4)11-12(15)2/h7-8,10,12-13,15,18H,6,9,11H2,1-5H3 |
| InChIKey | HIDROPSVNAJQDB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|