C15H23ClN2O — CID 43665336
N-(3-chloro-4-methoxyphenyl)-1,2,5-trimethylpiperidin-4-amine (PubChem CID 43665336) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-1,2,5-trimethylpiperidin-4-amine.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-1,2,5-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 43665336 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-1,2,5-trimethylpiperidin-4-amine |
| SMILES | COc1ccc(NC2CC(C)N(C)CC2C)cc1Cl |
| InChI | InChI=1S/C15H23ClN2O/c1-10-9-18(3)11(2)7-14(10)17-12-5-6-15(19-4)13(16)8-12/h5-6,8,10-11,14,17H,7,9H2,1-4H3 |
| InChIKey | AGBJNBBLWXURNR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|