C14H20BrN3O2 — CID 82865025
N-(3-bromo-4-nitrophenyl)-1,2,5-trimethylpiperidin-4-amine (PubChem CID 82865025) has the molecular formula C14H20BrN3O2 and a molecular weight of 342.24 g/mol. Its IUPAC name is N-(3-bromo-4-nitrophenyl)-1,2,5-trimethylpiperidin-4-amine.
| Compound Name | N-(3-bromo-4-nitrophenyl)-1,2,5-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 82865025 |
| Molecular Formula | C14H20BrN3O2 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | N-(3-bromo-4-nitrophenyl)-1,2,5-trimethylpiperidin-4-amine |
| SMILES | CC1CN(C)C(C)CC1Nc1ccc([N+](=O)[O-])c(Br)c1 |
| InChI | InChI=1S/C14H20BrN3O2/c1-9-8-17(3)10(2)6-13(9)16-11-4-5-14(18(19)20)12(15)7-11/h4-5,7,9-10,13,16H,6,8H2,1-3H3 |
| InChIKey | IXSIVEOMNGABIO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|