C16H24ClN3O — CID 60936196
2-chloro-N-methyl-5-[(1,2,5-trimethylpiperidin-4-yl)amino]benzamide (PubChem CID 60936196) has the molecular formula C16H24ClN3O and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-chloro-N-methyl-5-[(1,2,5-trimethylpiperidin-4-yl)amino]benzamide.
| Compound Name | 2-chloro-N-methyl-5-[(1,2,5-trimethylpiperidin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 60936196 |
| Molecular Formula | C16H24ClN3O |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-chloro-N-methyl-5-[(1,2,5-trimethylpiperidin-4-yl)amino]benzamide |
| SMILES | CNC(=O)c1cc(NC2CC(C)N(C)CC2C)ccc1Cl |
| InChI | InChI=1S/C16H24ClN3O/c1-10-9-20(4)11(2)7-15(10)19-12-5-6-14(17)13(8-12)16(21)18-3/h5-6,8,10-11,15,19H,7,9H2,1-4H3,(H,18,21) |
| InChIKey | JSMUOOWILFNYCI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |