C10H12BrN3O2 — CID 82864711
1-N-(3-bromo-4-nitrophenyl)cyclobutane-1,3-diamine (PubChem CID 82864711) has the molecular formula C10H12BrN3O2 and a molecular weight of 286.13 g/mol. Its IUPAC name is 1-N-(3-bromo-4-nitrophenyl)cyclobutane-1,3-diamine.
| Compound Name | 1-N-(3-bromo-4-nitrophenyl)cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 82864711 |
| Molecular Formula | C10H12BrN3O2 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 1-N-(3-bromo-4-nitrophenyl)cyclobutane-1,3-diamine |
| SMILES | NC1CC(Nc2ccc([N+](=O)[O-])c(Br)c2)C1 |
| InChI | InChI=1S/C10H12BrN3O2/c11-9-5-7(1-2-10(9)14(15)16)13-8-3-6(12)4-8/h1-2,5-6,8,13H,3-4,12H2 |
| InChIKey | MWEYOHLTCJWBLZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|