C13H13BrN2O2S — CID 43720284
2-[3-[(4-bromothiophen-2-yl)methylamino]phenoxy]acetamide (PubChem CID 43720284) has the molecular formula C13H13BrN2O2S and a molecular weight of 341.23 g/mol. Its IUPAC name is 2-[3-[(4-bromothiophen-2-yl)methylamino]phenoxy]acetamide.
| Compound Name | 2-[3-[(4-bromothiophen-2-yl)methylamino]phenoxy]acetamide |
|---|---|
| PubChem CID | 43720284 |
| Molecular Formula | C13H13BrN2O2S |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 2-[3-[(4-bromothiophen-2-yl)methylamino]phenoxy]acetamide |
| SMILES | NC(=O)COc1cccc(NCc2cc(Br)cs2)c1 |
| InChI | InChI=1S/C13H13BrN2O2S/c14-9-4-12(19-8-9)6-16-10-2-1-3-11(5-10)18-7-13(15)17/h1-5,8,16H,6-7H2,(H2,15,17) |
| InChIKey | WRFKXZRNKDNVQY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |