C15H18N2O2S — CID 79614000
5-[(3-propoxyanilino)methyl]thiophene-3-carboxamide (PubChem CID 79614000) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 5-[(3-propoxyanilino)methyl]thiophene-3-carboxamide.
| Compound Name | 5-[(3-propoxyanilino)methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79614000 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 5-[(3-propoxyanilino)methyl]thiophene-3-carboxamide |
| SMILES | CCCOc1cccc(NCc2cc(C(N)=O)cs2)c1 |
| InChI | InChI=1S/C15H18N2O2S/c1-2-6-19-13-5-3-4-12(8-13)17-9-14-7-11(10-20-14)15(16)18/h3-5,7-8,10,17H,2,6,9H2,1H3,(H2,16,18) |
| InChIKey | SDLFFBNDLLVVMW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |