C13H15N3O3S2 — CID 79611128
5-[[3-(methylsulfamoyl)anilino]methyl]thiophene-3-carboxamide (PubChem CID 79611128) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 5-[[3-(methylsulfamoyl)anilino]methyl]thiophene-3-carboxamide.
| Compound Name | 5-[[3-(methylsulfamoyl)anilino]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79611128 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 5-[[3-(methylsulfamoyl)anilino]methyl]thiophene-3-carboxamide |
| SMILES | CNS(=O)(=O)c1cccc(NCc2cc(C(N)=O)cs2)c1 |
| InChI | InChI=1S/C13H15N3O3S2/c1-15-21(18,19)12-4-2-3-10(6-12)16-7-11-5-9(8-20-11)13(14)17/h2-6,8,15-16H,7H2,1H3,(H2,14,17) |
| InChIKey | AVXFMSXKECUBQS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |