C16H16N2O2S — CID 43723169
6-[1-(4-hydroxyphenyl)ethylamino]-4H-1,4-benzothiazin-3-one (PubChem CID 43723169) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 6-[1-(4-hydroxyphenyl)ethylamino]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[1-(4-hydroxyphenyl)ethylamino]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 43723169 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 6-[1-(4-hydroxyphenyl)ethylamino]-4H-1,4-benzothiazin-3-one |
| SMILES | CC(Nc1ccc2c(c1)NC(=O)CS2)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H16N2O2S/c1-10(11-2-5-13(19)6-3-11)17-12-4-7-15-14(8-12)18-16(20)9-21-15/h2-8,10,17,19H,9H2,1H3,(H,18,20) |
| InChIKey | CPYIZMWLJUISTF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |