C16H15ClN2OS — CID 43226997
6-[1-(2-chlorophenyl)ethylamino]-4H-1,4-benzothiazin-3-one (PubChem CID 43226997) has the molecular formula C16H15ClN2OS and a molecular weight of 318.83 g/mol. Its IUPAC name is 6-[1-(2-chlorophenyl)ethylamino]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[1-(2-chlorophenyl)ethylamino]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 43226997 |
| Molecular Formula | C16H15ClN2OS |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 6-[1-(2-chlorophenyl)ethylamino]-4H-1,4-benzothiazin-3-one |
| SMILES | CC(Nc1ccc2c(c1)NC(=O)CS2)c1ccccc1Cl |
| InChI | InChI=1S/C16H15ClN2OS/c1-10(12-4-2-3-5-13(12)17)18-11-6-7-15-14(8-11)19-16(20)9-21-15/h2-8,10,18H,9H2,1H3,(H,19,20) |
| InChIKey | PGLRCAJXSVKPTH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |