C17H17ClN2OS — CID 166219035
6-[2-(3-chlorophenyl)propylamino]-4H-1,4-benzothiazin-3-one (PubChem CID 166219035) has the molecular formula C17H17ClN2OS and a molecular weight of 332.86 g/mol. Its IUPAC name is 6-[2-(3-chlorophenyl)propylamino]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[2-(3-chlorophenyl)propylamino]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 166219035 |
| Molecular Formula | C17H17ClN2OS |
| Molecular Weight | 332.86 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 6-[2-(3-chlorophenyl)propylamino]-4H-1,4-benzothiazin-3-one |
| SMILES | CC(CNc1ccc2c(c1)NC(=O)CS2)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H17ClN2OS/c1-11(12-3-2-4-13(18)7-12)9-19-14-5-6-16-15(8-14)20-17(21)10-22-16/h2-8,11,19H,9-10H2,1H3,(H,20,21) |
| InChIKey | CWYKTBOTTFTQNL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.86 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |