C15H17NS2 — CID 43724571
N-(2-thiophen-2-ylphenyl)thian-4-amine (PubChem CID 43724571) has the molecular formula C15H17NS2 and a molecular weight of 275.44 g/mol. Its IUPAC name is N-(2-thiophen-2-ylphenyl)thian-4-amine.
| Compound Name | N-(2-thiophen-2-ylphenyl)thian-4-amine |
|---|---|
| PubChem CID | 43724571 |
| Molecular Formula | C15H17NS2 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-(2-thiophen-2-ylphenyl)thian-4-amine |
| SMILES | c1csc(-c2ccccc2NC2CCSCC2)c1 |
| InChI | InChI=1S/C15H17NS2/c1-2-5-14(16-12-7-10-17-11-8-12)13(4-1)15-6-3-9-18-15/h1-6,9,12,16H,7-8,10-11H2 |
| InChIKey | MNPCZJUDHOJMMO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |