C15H15N3O2 — CID 43727252
3-[3-(pyridin-3-ylmethylamino)phenyl]-1,3-oxazolidin-2-one (PubChem CID 43727252) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-[3-(pyridin-3-ylmethylamino)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-(pyridin-3-ylmethylamino)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 43727252 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-[3-(pyridin-3-ylmethylamino)phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1cccc(NCc2cccnc2)c1 |
| InChI | InChI=1S/C15H15N3O2/c19-15-18(7-8-20-15)14-5-1-4-13(9-14)17-11-12-3-2-6-16-10-12/h1-6,9-10,17H,7-8,11H2 |
| InChIKey | SNQVHTJKPYHYJZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |