C17H24FNO2 — CID 43728096
4-fluoro-3-[(5-methyl-2-propan-2-ylcyclohexyl)amino]benzoic acid (PubChem CID 43728096) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is 4-fluoro-3-[(5-methyl-2-propan-2-ylcyclohexyl)amino]benzoic acid.
| Compound Name | 4-fluoro-3-[(5-methyl-2-propan-2-ylcyclohexyl)amino]benzoic acid |
|---|---|
| PubChem CID | 43728096 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 4-fluoro-3-[(5-methyl-2-propan-2-ylcyclohexyl)amino]benzoic acid |
| SMILES | CC1CCC(C(C)C)C(Nc2cc(C(=O)O)ccc2F)C1 |
| InChI | InChI=1S/C17H24FNO2/c1-10(2)13-6-4-11(3)8-15(13)19-16-9-12(17(20)21)5-7-14(16)18/h5,7,9-11,13,15,19H,4,6,8H2,1-3H3,(H,20,21) |
| InChIKey | ORKMLAPAMWJTQJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |