C18H26N2O4 — CID 175057673
[4-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]amino]-3-nitrophenyl] acetate (PubChem CID 175057673) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is [4-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]amino]-3-nitrophenyl] acetate.
| Compound Name | [4-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]amino]-3-nitrophenyl] acetate |
|---|---|
| PubChem CID | 175057673 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | [4-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]amino]-3-nitrophenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N[C@@H]2C[C@H](C)CC[C@H]2C(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H26N2O4/c1-11(2)15-7-5-12(3)9-17(15)19-16-8-6-14(24-13(4)21)10-18(16)20(22)23/h6,8,10-12,15,17,19H,5,7,9H2,1-4H3/t12-,15+,17-/m1/s1 |
| InChIKey | UMAIBTUOUDATLW-ISTRZQFTSA-N |
| XLogP | 4.39 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|