C20H32N2O2 — CID 138488557
methyl 3-[3-amino-4-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]amino]phenyl]propanoate (PubChem CID 138488557) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is methyl 3-[3-amino-4-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]amino]phenyl]propanoate.
| Compound Name | methyl 3-[3-amino-4-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]amino]phenyl]propanoate |
|---|---|
| PubChem CID | 138488557 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | methyl 3-[3-amino-4-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]amino]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(NC2C[C@H](C)CC[C@H]2C(C)C)c(N)c1 |
| InChI | InChI=1S/C20H32N2O2/c1-13(2)16-8-5-14(3)11-19(16)22-18-9-6-15(12-17(18)21)7-10-20(23)24-4/h6,9,12-14,16,19,22H,5,7-8,10-11,21H2,1-4H3/t14-,16+,19?/m1/s1 |
| InChIKey | GLOQHCWSBRRTGF-ZMWCROOCSA-N |
| XLogP | 4.25 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|