C13H19F2NO2 — CID 43731307
3-(difluoromethoxy)-4-methoxy-N-(2-methylbutyl)aniline (PubChem CID 43731307) has the molecular formula C13H19F2NO2 and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-(difluoromethoxy)-4-methoxy-N-(2-methylbutyl)aniline.
| Compound Name | 3-(difluoromethoxy)-4-methoxy-N-(2-methylbutyl)aniline |
|---|---|
| PubChem CID | 43731307 |
| Molecular Formula | C13H19F2NO2 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-(difluoromethoxy)-4-methoxy-N-(2-methylbutyl)aniline |
| SMILES | CCC(C)CNc1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C13H19F2NO2/c1-4-9(2)8-16-10-5-6-11(17-3)12(7-10)18-13(14)15/h5-7,9,13,16H,4,8H2,1-3H3 |
| InChIKey | BKCIZHPJNWDDKK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|