C13H19F2NO4S — CID 115917397
3-(difluoromethoxy)-N-(1-ethylsulfonylpropan-2-yl)-4-methoxyaniline (PubChem CID 115917397) has the molecular formula C13H19F2NO4S and a molecular weight of 323.36 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-(1-ethylsulfonylpropan-2-yl)-4-methoxyaniline.
| Compound Name | 3-(difluoromethoxy)-N-(1-ethylsulfonylpropan-2-yl)-4-methoxyaniline |
|---|---|
| PubChem CID | 115917397 |
| Molecular Formula | C13H19F2NO4S |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 3-(difluoromethoxy)-N-(1-ethylsulfonylpropan-2-yl)-4-methoxyaniline |
| SMILES | CCS(=O)(=O)CC(C)Nc1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C13H19F2NO4S/c1-4-21(17,18)8-9(2)16-10-5-6-11(19-3)12(7-10)20-13(14)15/h5-7,9,13,16H,4,8H2,1-3H3 |
| InChIKey | HHXRVTQWPQCTPM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|