C17H20N2O2 — CID 43732176
4-[(4-pyrrolidin-1-ylanilino)methyl]benzene-1,2-diol (PubChem CID 43732176) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-[(4-pyrrolidin-1-ylanilino)methyl]benzene-1,2-diol.
| Compound Name | 4-[(4-pyrrolidin-1-ylanilino)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 43732176 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 4-[(4-pyrrolidin-1-ylanilino)methyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CNc2ccc(N3CCCC3)cc2)cc1O |
| InChI | InChI=1S/C17H20N2O2/c20-16-8-3-13(11-17(16)21)12-18-14-4-6-15(7-5-14)19-9-1-2-10-19/h3-8,11,18,20-21H,1-2,9-10,12H2 |
| InChIKey | HXNBOSMBCFPBCD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|