C17H18Cl2N2 — CID 60790170
N-[(3,5-dichlorophenyl)methyl]-4-pyrrolidin-1-ylaniline (PubChem CID 60790170) has the molecular formula C17H18Cl2N2 and a molecular weight of 321.25 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)methyl]-4-pyrrolidin-1-ylaniline.
| Compound Name | N-[(3,5-dichlorophenyl)methyl]-4-pyrrolidin-1-ylaniline |
|---|---|
| PubChem CID | 60790170 |
| Molecular Formula | C17H18Cl2N2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-[(3,5-dichlorophenyl)methyl]-4-pyrrolidin-1-ylaniline |
| SMILES | Clc1cc(Cl)cc(CNc2ccc(N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C17H18Cl2N2/c18-14-9-13(10-15(19)11-14)12-20-16-3-5-17(6-4-16)21-7-1-2-8-21/h3-6,9-11,20H,1-2,7-8,12H2 |
| InChIKey | HQSDOHIMPAONNX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|