C17H18ClFN2 — CID 115761922
N-[(5-chloro-2-fluorophenyl)methyl]-4-pyrrolidin-1-ylaniline (PubChem CID 115761922) has the molecular formula C17H18ClFN2 and a molecular weight of 304.80 g/mol. Its IUPAC name is N-[(5-chloro-2-fluorophenyl)methyl]-4-pyrrolidin-1-ylaniline.
| Compound Name | N-[(5-chloro-2-fluorophenyl)methyl]-4-pyrrolidin-1-ylaniline |
|---|---|
| PubChem CID | 115761922 |
| Molecular Formula | C17H18ClFN2 |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-[(5-chloro-2-fluorophenyl)methyl]-4-pyrrolidin-1-ylaniline |
| SMILES | Fc1ccc(Cl)cc1CNc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C17H18ClFN2/c18-14-3-8-17(19)13(11-14)12-20-15-4-6-16(7-5-15)21-9-1-2-10-21/h3-8,11,20H,1-2,9-10,12H2 |
| InChIKey | CTYBHPZOUMSMGT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|