C15H15ClINO2 — CID 43733612
2-chloro-N-[(3,4-dimethoxyphenyl)methyl]-4-iodoaniline (PubChem CID 43733612) has the molecular formula C15H15ClINO2 and a molecular weight of 403.65 g/mol. Its IUPAC name is 2-chloro-N-[(3,4-dimethoxyphenyl)methyl]-4-iodoaniline.
| Compound Name | 2-chloro-N-[(3,4-dimethoxyphenyl)methyl]-4-iodoaniline |
|---|---|
| PubChem CID | 43733612 |
| Molecular Formula | C15H15ClINO2 |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | 2-chloro-N-[(3,4-dimethoxyphenyl)methyl]-4-iodoaniline |
| SMILES | COc1ccc(CNc2ccc(I)cc2Cl)cc1OC |
| InChI | InChI=1S/C15H15ClINO2/c1-19-14-6-3-10(7-15(14)20-2)9-18-13-5-4-11(17)8-12(13)16/h3-8,18H,9H2,1-2H3 |
| InChIKey | VMNPPDWNOYXAFB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|