C16H16N2O3 — CID 43737966
6-[(2,4-dihydroxyphenyl)methylamino]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 43737966) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is 6-[(2,4-dihydroxyphenyl)methylamino]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[(2,4-dihydroxyphenyl)methylamino]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 43737966 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 6-[(2,4-dihydroxyphenyl)methylamino]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(NCc3ccc(O)cc3O)ccc2N1 |
| InChI | InChI=1S/C16H16N2O3/c19-13-4-1-11(15(20)8-13)9-17-12-3-5-14-10(7-12)2-6-16(21)18-14/h1,3-5,7-8,17,19-20H,2,6,9H2,(H,18,21) |
| InChIKey | KDQWMVUGLCAQRB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|