C17H21NO3 — CID 43738907
4-methoxy-2-[(3-methoxy-2,4-dimethylanilino)methyl]phenol (PubChem CID 43738907) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-methoxy-2-[(3-methoxy-2,4-dimethylanilino)methyl]phenol.
| Compound Name | 4-methoxy-2-[(3-methoxy-2,4-dimethylanilino)methyl]phenol |
|---|---|
| PubChem CID | 43738907 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-methoxy-2-[(3-methoxy-2,4-dimethylanilino)methyl]phenol |
| SMILES | COc1ccc(O)c(CNc2ccc(C)c(OC)c2C)c1 |
| InChI | InChI=1S/C17H21NO3/c1-11-5-7-15(12(2)17(11)21-4)18-10-13-9-14(20-3)6-8-16(13)19/h5-9,18-19H,10H2,1-4H3 |
| InChIKey | GSRWCRHBFHUUSM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|