C14H12BrN3O3 — CID 43741346
5-bromo-6-[(2,4-dihydroxyphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 43741346) has the molecular formula C14H12BrN3O3 and a molecular weight of 350.17 g/mol. Its IUPAC name is 5-bromo-6-[(2,4-dihydroxyphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-bromo-6-[(2,4-dihydroxyphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 43741346 |
| Molecular Formula | C14H12BrN3O3 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 5-bromo-6-[(2,4-dihydroxyphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2cc(Br)c(NCc3ccc(O)cc3O)cc2[nH]1 |
| InChI | InChI=1S/C14H12BrN3O3/c15-9-4-11-12(18-14(21)17-11)5-10(9)16-6-7-1-2-8(19)3-13(7)20/h1-5,16,19-20H,6H2,(H2,17,18,21) |
| InChIKey | ALHXQLORIPEGSC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|