C15H23BrN2O2 — CID 43746544
4-bromo-N-(2,6-dimethylheptan-4-yl)-2-nitroaniline (PubChem CID 43746544) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.27 g/mol. Its IUPAC name is 4-bromo-N-(2,6-dimethylheptan-4-yl)-2-nitroaniline.
| Compound Name | 4-bromo-N-(2,6-dimethylheptan-4-yl)-2-nitroaniline |
|---|---|
| PubChem CID | 43746544 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4-bromo-N-(2,6-dimethylheptan-4-yl)-2-nitroaniline |
| SMILES | CC(C)CC(CC(C)C)Nc1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H23BrN2O2/c1-10(2)7-13(8-11(3)4)17-14-6-5-12(16)9-15(14)18(19)20/h5-6,9-11,13,17H,7-8H2,1-4H3 |
| InChIKey | JWFSIIDEHMXTPK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|