C14H22IN3O2 — CID 66066470
2-N-(4-iodo-2-nitrophenyl)-1-N,1-N,4-trimethylpentane-1,2-diamine (PubChem CID 66066470) has the molecular formula C14H22IN3O2 and a molecular weight of 391.25 g/mol. Its IUPAC name is 2-N-(4-iodo-2-nitrophenyl)-1-N,1-N,4-trimethylpentane-1,2-diamine.
| Compound Name | 2-N-(4-iodo-2-nitrophenyl)-1-N,1-N,4-trimethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 66066470 |
| Molecular Formula | C14H22IN3O2 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 2-N-(4-iodo-2-nitrophenyl)-1-N,1-N,4-trimethylpentane-1,2-diamine |
| SMILES | CC(C)CC(CN(C)C)Nc1ccc(I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H22IN3O2/c1-10(2)7-12(9-17(3)4)16-13-6-5-11(15)8-14(13)18(19)20/h5-6,8,10,12,16H,7,9H2,1-4H3 |
| InChIKey | ZUCAHLUZCVWSAW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|