C14H11BrN2O4 — CID 43746630
3-(4-bromo-2-nitroanilino)-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 43746630) has the molecular formula C14H11BrN2O4 and a molecular weight of 351.16 g/mol. Its IUPAC name is 3-(4-bromo-2-nitroanilino)-2,3-dihydro-1-benzofuran-6-ol.
| Compound Name | 3-(4-bromo-2-nitroanilino)-2,3-dihydro-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 43746630 |
| Molecular Formula | C14H11BrN2O4 |
| Molecular Weight | 351.16 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 3-(4-bromo-2-nitroanilino)-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1NC1COc2cc(O)ccc21 |
| InChI | InChI=1S/C14H11BrN2O4/c15-8-1-4-11(13(5-8)17(19)20)16-12-7-21-14-6-9(18)2-3-10(12)14/h1-6,12,16,18H,7H2 |
| InChIKey | QGPNQXAYGJCQGQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.16 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|