C15H13Br2NO2 — CID 43126164
3-(2,6-dibromo-4-methylanilino)-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 43126164) has the molecular formula C15H13Br2NO2 and a molecular weight of 399.08 g/mol. Its IUPAC name is 3-(2,6-dibromo-4-methylanilino)-2,3-dihydro-1-benzofuran-6-ol.
| Compound Name | 3-(2,6-dibromo-4-methylanilino)-2,3-dihydro-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 43126164 |
| Molecular Formula | C15H13Br2NO2 |
| Molecular Weight | 399.08 g/mol |
| Exact Mass | 396.93 |
| IUPAC Name | 3-(2,6-dibromo-4-methylanilino)-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | Cc1cc(Br)c(NC2COc3cc(O)ccc32)c(Br)c1 |
| InChI | InChI=1S/C15H13Br2NO2/c1-8-4-11(16)15(12(17)5-8)18-13-7-20-14-6-9(19)2-3-10(13)14/h2-6,13,18-19H,7H2,1H3 |
| InChIKey | CVEDHMCDRLDKDY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.08 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |