C12H21N3O2S — CID 43752008
N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-1,1-dioxothian-4-amine (PubChem CID 43752008) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-1,1-dioxothian-4-amine.
| Compound Name | N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43752008 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-1,1-dioxothian-4-amine |
| SMILES | Cc1c(C(C)NC2CCS(=O)(=O)CC2)cnn1C |
| InChI | InChI=1S/C12H21N3O2S/c1-9(12-8-13-15(3)10(12)2)14-11-4-6-18(16,17)7-5-11/h8-9,11,14H,4-7H2,1-3H3 |
| InChIKey | RJNZBHZHVOLQBJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |